C17H25F3N2O — CID 4535202
N-[5-(diethylamino)pentan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 4535202) has the molecular formula C17H25F3N2O and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4535202 |
| Molecular Formula | C17H25F3N2O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3N2O/c1-4-22(5-2)12-6-7-13(3)21-16(23)14-8-10-15(11-9-14)17(18,19)20/h8-11,13H,4-7,12H2,1-3H3,(H,21,23) |
| InChIKey | AZBVDJMXKPDOBD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |