C25H31ClN4O — CID 92767970
4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N-[(2R)-5-(diethylamino)pentan-2-yl]benzamide (PubChem CID 92767970) has the molecular formula C25H31ClN4O and a molecular weight of 439.00 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N-[(2R)-5-(diethylamino)pentan-2-yl]benzamide.
| Compound Name | 4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N-[(2R)-5-(diethylamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 92767970 |
| Molecular Formula | C25H31ClN4O |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N-[(2R)-5-(diethylamino)pentan-2-yl]benzamide |
| SMILES | CCN(CC)CCC[C@@H](C)NC(=O)c1ccc(-c2cc(-c3ccc(Cl)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C25H31ClN4O/c1-4-30(5-2)16-6-7-18(3)27-25(31)21-10-8-19(9-11-21)23-17-24(29-28-23)20-12-14-22(26)15-13-20/h8-15,17-18H,4-7,16H2,1-3H3,(H,27,31)(H,28,29)/t18-/m1/s1 |
| InChIKey | UGZNPKSIWGMDLV-GOSISDBHSA-N |
| XLogP | 5.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |