C15H25N3O2 — CID 63865105
N-[5-(diethylamino)pentan-2-yl]-5-hydroxypyridine-3-carboxamide (PubChem CID 63865105) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-5-hydroxypyridine-3-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-5-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 63865105 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-5-hydroxypyridine-3-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C15H25N3O2/c1-4-18(5-2)8-6-7-12(3)17-15(20)13-9-14(19)11-16-10-13/h9-12,19H,4-8H2,1-3H3,(H,17,20) |
| InChIKey | OXHZEAIWLJPSRE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |