C22H24ClN3O3 — CID 91633917
4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 91633917) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 91633917 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1ccc(-c2cc(-c3ccc(Cl)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-28-13-11-26(12-14-29-2)22(27)18-5-3-16(4-6-18)20-15-21(25-24-20)17-7-9-19(23)10-8-17/h3-10,15H,11-14H2,1-2H3,(H,24,25) |
| InChIKey | MCRUYDDZUCGCFM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |