C11H13F3N2O — CID 120506253
N-[(2S)-1-aminopropan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 120506253) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 120506253 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](CN)NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O/c1-7(6-15)16-10(17)8-2-4-9(5-3-8)11(12,13)14/h2-5,7H,6,15H2,1H3,(H,16,17)/t7-/m0/s1 |
| InChIKey | BVUWWBJIXPMDAG-ZETCQYMHSA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |