C22H38N2O2 — CID 110185768
2-methylbutyl 2-[2-(diethylamino)ethylamino]-2-(4-propan-2-ylphenyl)acetate (PubChem CID 110185768) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 2-methylbutyl 2-[2-(diethylamino)ethylamino]-2-(4-propan-2-ylphenyl)acetate.
| Compound Name | 2-methylbutyl 2-[2-(diethylamino)ethylamino]-2-(4-propan-2-ylphenyl)acetate |
|---|---|
| PubChem CID | 110185768 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 2-methylbutyl 2-[2-(diethylamino)ethylamino]-2-(4-propan-2-ylphenyl)acetate |
| SMILES | CCC(C)COC(=O)C(NCCN(CC)CC)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O2/c1-7-18(6)16-26-22(25)21(23-14-15-24(8-2)9-3)20-12-10-19(11-13-20)17(4)5/h10-13,17-18,21,23H,7-9,14-16H2,1-6H3 |
| InChIKey | YLIQXLFCNCGJGI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |