C11H15BrClNO2S — CID 102844851
3-(4-bromo-5-chlorothiophen-2-yl)-3-(diethylamino)propanoic acid (PubChem CID 102844851) has the molecular formula C11H15BrClNO2S and a molecular weight of 340.67 g/mol. Its IUPAC name is 3-(4-bromo-5-chlorothiophen-2-yl)-3-(diethylamino)propanoic acid.
| Compound Name | 3-(4-bromo-5-chlorothiophen-2-yl)-3-(diethylamino)propanoic acid |
|---|---|
| PubChem CID | 102844851 |
| Molecular Formula | C11H15BrClNO2S |
| Molecular Weight | 340.67 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-(4-bromo-5-chlorothiophen-2-yl)-3-(diethylamino)propanoic acid |
| SMILES | CCN(CC)C(CC(=O)O)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C11H15BrClNO2S/c1-3-14(4-2)8(6-10(15)16)9-5-7(12)11(13)17-9/h5,8H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | LZCGMICLKTYJOX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |