C14H20BrClN2OS — CID 102828964
2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclohexyl]acetamide (PubChem CID 102828964) has the molecular formula C14H20BrClN2OS and a molecular weight of 379.75 g/mol. Its IUPAC name is 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclohexyl]acetamide.
| Compound Name | 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 102828964 |
| Molecular Formula | C14H20BrClN2OS |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclohexyl]acetamide |
| SMILES | NC(=O)CC1(CC(N)c2cc(Br)c(Cl)s2)CCCCC1 |
| InChI | InChI=1S/C14H20BrClN2OS/c15-9-6-11(20-13(9)16)10(17)7-14(8-12(18)19)4-2-1-3-5-14/h6,10H,1-5,7-8,17H2,(H2,18,19) |
| InChIKey | KAZLMCGCDZCXOC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |