C12H17BrClNS — CID 102828032
(4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopentyl)methanamine (PubChem CID 102828032) has the molecular formula C12H17BrClNS and a molecular weight of 322.70 g/mol. Its IUPAC name is (4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopentyl)methanamine.
| Compound Name | (4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 102828032 |
| Molecular Formula | C12H17BrClNS |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopentyl)methanamine |
| SMILES | CCC1(C(N)c2cc(Br)c(Cl)s2)CCCC1 |
| InChI | InChI=1S/C12H17BrClNS/c1-2-12(5-3-4-6-12)10(15)9-7-8(13)11(14)16-9/h7,10H,2-6,15H2,1H3 |
| InChIKey | UPWDPUUFFRYDTA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |