C10H12BrClOS — CID 130553458
(4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopropyl)methanol (PubChem CID 130553458) has the molecular formula C10H12BrClOS and a molecular weight of 295.63 g/mol. Its IUPAC name is (4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopropyl)methanol.
| Compound Name | (4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopropyl)methanol |
|---|---|
| PubChem CID | 130553458 |
| Molecular Formula | C10H12BrClOS |
| Molecular Weight | 295.63 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | (4-bromo-5-chlorothiophen-2-yl)-(1-ethylcyclopropyl)methanol |
| SMILES | CCC1(C(O)c2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C10H12BrClOS/c1-2-10(3-4-10)8(13)7-5-6(11)9(12)14-7/h5,8,13H,2-4H2,1H3 |
| InChIKey | BRPPQSIBDWZION-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |