C9H11BrClNOS — CID 130513429
[1-(aminomethyl)cyclopropyl]-(4-bromo-5-chlorothiophen-2-yl)methanol (PubChem CID 130513429) has the molecular formula C9H11BrClNOS and a molecular weight of 296.62 g/mol. Its IUPAC name is [1-(aminomethyl)cyclopropyl]-(4-bromo-5-chlorothiophen-2-yl)methanol.
| Compound Name | [1-(aminomethyl)cyclopropyl]-(4-bromo-5-chlorothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 130513429 |
| Molecular Formula | C9H11BrClNOS |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 294.94 |
| IUPAC Name | [1-(aminomethyl)cyclopropyl]-(4-bromo-5-chlorothiophen-2-yl)methanol |
| SMILES | NCC1(C(O)c2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C9H11BrClNOS/c10-5-3-6(14-8(5)11)7(13)9(4-12)1-2-9/h3,7,13H,1-2,4,12H2 |
| InChIKey | OCXVEUPLKRUPMG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |