C14H21BrClNOS — CID 102845379
[1-(aminomethyl)-4-ethylcyclohexyl]-(4-bromo-5-chlorothiophen-2-yl)methanol (PubChem CID 102845379) has the molecular formula C14H21BrClNOS and a molecular weight of 366.75 g/mol. Its IUPAC name is [1-(aminomethyl)-4-ethylcyclohexyl]-(4-bromo-5-chlorothiophen-2-yl)methanol.
| Compound Name | [1-(aminomethyl)-4-ethylcyclohexyl]-(4-bromo-5-chlorothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 102845379 |
| Molecular Formula | C14H21BrClNOS |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | [1-(aminomethyl)-4-ethylcyclohexyl]-(4-bromo-5-chlorothiophen-2-yl)methanol |
| SMILES | CCC1CCC(CN)(C(O)c2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C14H21BrClNOS/c1-2-9-3-5-14(8-17,6-4-9)12(18)11-7-10(15)13(16)19-11/h7,9,12,18H,2-6,8,17H2,1H3 |
| InChIKey | CIQZUIXBSIAJSO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |