C15H21BrClNO2S — CID 102828971
ethyl 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]acetate (PubChem CID 102828971) has the molecular formula C15H21BrClNO2S and a molecular weight of 394.76 g/mol. Its IUPAC name is ethyl 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]acetate.
| Compound Name | ethyl 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 102828971 |
| Molecular Formula | C15H21BrClNO2S |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | ethyl 2-[1-[2-amino-2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]acetate |
| SMILES | CCOC(=O)CC1(CC(N)c2cc(Br)c(Cl)s2)CCCC1 |
| InChI | InChI=1S/C15H21BrClNO2S/c1-2-20-13(19)9-15(5-3-4-6-15)8-11(18)12-7-10(16)14(17)21-12/h7,11H,2-6,8-9,18H2,1H3 |
| InChIKey | ADPCFSPRZZWYNT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |