C7H7BrClNO2S — CID 102841274
(2S)-2-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanoic acid (PubChem CID 102841274) has the molecular formula C7H7BrClNO2S and a molecular weight of 284.56 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 102841274 |
| Molecular Formula | C7H7BrClNO2S |
| Molecular Weight | 284.56 g/mol |
| Exact Mass | 282.91 |
| IUPAC Name | (2S)-2-amino-3-(4-bromo-5-chlorothiophen-2-yl)propanoic acid |
| SMILES | N[C@@H](Cc1cc(Br)c(Cl)s1)C(=O)O |
| InChI | InChI=1S/C7H7BrClNO2S/c8-4-1-3(13-6(4)9)2-5(10)7(11)12/h1,5H,2,10H2,(H,11,12)/t5-/m0/s1 |
| InChIKey | HEBFMWMBOZRXMV-YFKPBYRVSA-N |
| XLogP | 2.12 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |