C9H8Br3NO2 — CID 131862569
(2S)-2-amino-3-(2,3,5-tribromophenyl)propanoic acid (PubChem CID 131862569) has the molecular formula C9H8Br3NO2 and a molecular weight of 401.88 g/mol. Its IUPAC name is (2S)-2-amino-3-(2,3,5-tribromophenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(2,3,5-tribromophenyl)propanoic acid |
|---|---|
| PubChem CID | 131862569 |
| Molecular Formula | C9H8Br3NO2 |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 398.81 |
| IUPAC Name | (2S)-2-amino-3-(2,3,5-tribromophenyl)propanoic acid |
| SMILES | N[C@@H](Cc1cc(Br)cc(Br)c1Br)C(=O)O |
| InChI | InChI=1S/C9H8Br3NO2/c10-5-1-4(2-7(13)9(14)15)8(12)6(11)3-5/h1,3,7H,2,13H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | YYDJYEGISPVMAI-ZETCQYMHSA-N |
| XLogP | 2.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|