C7H6BrClO3S — CID 125424978
(2R)-3-(4-bromo-5-chlorothiophen-2-yl)-2-hydroxypropanoic acid (PubChem CID 125424978) has the molecular formula C7H6BrClO3S and a molecular weight of 285.55 g/mol. Its IUPAC name is (2R)-3-(4-bromo-5-chlorothiophen-2-yl)-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-(4-bromo-5-chlorothiophen-2-yl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 125424978 |
| Molecular Formula | C7H6BrClO3S |
| Molecular Weight | 285.55 g/mol |
| Exact Mass | 283.89 |
| IUPAC Name | (2R)-3-(4-bromo-5-chlorothiophen-2-yl)-2-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](O)Cc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C7H6BrClO3S/c8-4-1-3(13-6(4)9)2-5(10)7(11)12/h1,5,10H,2H2,(H,11,12)/t5-/m1/s1 |
| InChIKey | BJPWMLGWGCBSGY-RXMQYKEDSA-N |
| XLogP | 2.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |