C8H11BrClNS — CID 102829960
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]propan-2-amine (PubChem CID 102829960) has the molecular formula C8H11BrClNS and a molecular weight of 268.61 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 102829960 |
| Molecular Formula | C8H11BrClNS |
| Molecular Weight | 268.61 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C8H11BrClNS/c1-5(2)11-4-6-3-7(9)8(10)12-6/h3,5,11H,4H2,1-2H3 |
| InChIKey | KBDOYZRKVFQOIB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |