C9H13BrClNS2 — CID 102837449
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfanylpropan-1-amine (PubChem CID 102837449) has the molecular formula C9H13BrClNS2 and a molecular weight of 314.70 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfanylpropan-1-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 102837449 |
| Molecular Formula | C9H13BrClNS2 |
| Molecular Weight | 314.70 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfanylpropan-1-amine |
| SMILES | CSC(C)CNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C9H13BrClNS2/c1-6(13-2)4-12-5-7-3-8(10)9(11)14-7/h3,6,12H,4-5H2,1-2H3 |
| InChIKey | VEDQLILJTCXSEK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |