C8H11BrClNOS2 — CID 102837533
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfinylethanamine (PubChem CID 102837533) has the molecular formula C8H11BrClNOS2 and a molecular weight of 316.67 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 102837533 |
| Molecular Formula | C8H11BrClNOS2 |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C8H11BrClNOS2/c1-14(12)3-2-11-5-6-4-7(9)8(10)13-6/h4,11H,2-3,5H2,1H3 |
| InChIKey | SOWBFNQUBNGREH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|