C9H13BrClNO2S2 — CID 102834762
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-methylsulfonylpropan-1-amine (PubChem CID 102834762) has the molecular formula C9H13BrClNO2S2 and a molecular weight of 346.70 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 102834762 |
| Molecular Formula | C9H13BrClNO2S2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCCNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C9H13BrClNO2S2/c1-16(13,14)4-2-3-12-6-7-5-8(10)9(11)15-7/h5,12H,2-4,6H2,1H3 |
| InChIKey | ZBUZAAHWXXHGTH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|