C13H19BrClNS — CID 106007961
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-cyclopentylpropan-1-amine (PubChem CID 106007961) has the molecular formula C13H19BrClNS and a molecular weight of 336.73 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-cyclopentylpropan-1-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-cyclopentylpropan-1-amine |
|---|---|
| PubChem CID | 106007961 |
| Molecular Formula | C13H19BrClNS |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-3-cyclopentylpropan-1-amine |
| SMILES | Clc1sc(CNCCCC2CCCC2)cc1Br |
| InChI | InChI=1S/C13H19BrClNS/c14-12-8-11(17-13(12)15)9-16-7-3-6-10-4-1-2-5-10/h8,10,16H,1-7,9H2 |
| InChIKey | IMMPPLUMCOPWFZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|