C12H18BrClN2S — CID 102835162
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-1-(1-methylpiperidin-4-yl)methanamine (PubChem CID 102835162) has the molecular formula C12H18BrClN2S and a molecular weight of 337.71 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-1-(1-methylpiperidin-4-yl)methanamine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-1-(1-methylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 102835162 |
| Molecular Formula | C12H18BrClN2S |
| Molecular Weight | 337.71 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-1-(1-methylpiperidin-4-yl)methanamine |
| SMILES | CN1CCC(CNCc2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C12H18BrClN2S/c1-16-4-2-9(3-5-16)7-15-8-10-6-11(13)12(14)17-10/h6,9,15H,2-5,7-8H2,1H3 |
| InChIKey | KJQCHCAMVGQGSS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |