C10H14BrClN2OS — CID 120962467
4-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]pyrrolidin-3-ol (PubChem CID 120962467) has the molecular formula C10H14BrClN2OS and a molecular weight of 325.66 g/mol. Its IUPAC name is 4-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 4-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 120962467 |
| Molecular Formula | C10H14BrClN2OS |
| Molecular Weight | 325.66 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 4-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]pyrrolidin-3-ol |
| SMILES | OC1CNCC1CNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C10H14BrClN2OS/c11-8-1-7(16-10(8)12)4-13-2-6-3-14-5-9(6)15/h1,6,9,13-15H,2-5H2 |
| InChIKey | ANDYQKXMHRMMNK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.66 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |