C16H20Cl2N2OS — CID 120962948
4-[[[5-(2-chlorophenyl)thiophen-2-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962948) has the molecular formula C16H20Cl2N2OS and a molecular weight of 359.32 g/mol. Its IUPAC name is 4-[[[5-(2-chlorophenyl)thiophen-2-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[[5-(2-chlorophenyl)thiophen-2-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962948 |
| Molecular Formula | C16H20Cl2N2OS |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-[[[5-(2-chlorophenyl)thiophen-2-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.OC1CNCC1CNCc1ccc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C16H19ClN2OS.ClH/c17-14-4-2-1-3-13(14)16-6-5-12(21-16)9-18-7-11-8-19-10-15(11)20;/h1-6,11,15,18-20H,7-10H2;1H |
| InChIKey | KLFPAOZWOYDSHK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |