C12H17BrClNOS — CID 102836063
2-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 102836063) has the molecular formula C12H17BrClNOS and a molecular weight of 338.70 g/mol. Its IUPAC name is 2-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 2-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102836063 |
| Molecular Formula | C12H17BrClNOS |
| Molecular Weight | 338.70 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2-[[(4-bromo-5-chlorothiophen-2-yl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C12H17BrClNOS/c13-10-5-9(17-12(10)14)7-15-6-8-3-1-2-4-11(8)16/h5,8,11,15-16H,1-4,6-7H2 |
| InChIKey | KEOCEEVPQLEJRV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |