C13H17BrClNS — CID 102835755
1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-bromo-5-chlorothiophen-2-yl)methyl]methanamine (PubChem CID 102835755) has the molecular formula C13H17BrClNS and a molecular weight of 334.71 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-bromo-5-chlorothiophen-2-yl)methyl]methanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-bromo-5-chlorothiophen-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 102835755 |
| Molecular Formula | C13H17BrClNS |
| Molecular Weight | 334.71 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-bromo-5-chlorothiophen-2-yl)methyl]methanamine |
| SMILES | Clc1sc(CNCC2CC3CCC2C3)cc1Br |
| InChI | InChI=1S/C13H17BrClNS/c14-12-5-11(17-13(12)15)7-16-6-10-4-8-1-2-9(10)3-8/h5,8-10,16H,1-4,6-7H2 |
| InChIKey | LEDLKPBQCCOEMW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |