C16H24BrClN2O2S — CID 107244514
tert-butyl 2-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 107244514) has the molecular formula C16H24BrClN2O2S and a molecular weight of 423.80 g/mol. Its IUPAC name is tert-butyl 2-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107244514 |
| Molecular Formula | C16H24BrClN2O2S |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | tert-butyl 2-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C16H24BrClN2O2S/c1-16(2,3)22-15(21)20-8-4-5-11(20)6-7-19-10-12-9-13(17)14(18)23-12/h9,11,19H,4-8,10H2,1-3H3 |
| InChIKey | QHMUQELIZKEIAU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|