C15H25N3O2S — CID 107244411
tert-butyl 2-[2-(1,3-thiazol-5-ylmethylamino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 107244411) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is tert-butyl 2-[2-(1,3-thiazol-5-ylmethylamino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(1,3-thiazol-5-ylmethylamino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107244411 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl 2-[2-(1,3-thiazol-5-ylmethylamino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCNCc1cncs1 |
| InChI | InChI=1S/C15H25N3O2S/c1-15(2,3)20-14(19)18-8-4-5-12(18)6-7-16-9-13-10-17-11-21-13/h10-12,16H,4-9H2,1-3H3 |
| InChIKey | SQKDKHNRCQUACP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|