C15H22BrClN2O2S — CID 103527151
tert-butyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidine-1-carboxylate (PubChem CID 103527151) has the molecular formula C15H22BrClN2O2S and a molecular weight of 409.78 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103527151 |
| Molecular Formula | C15H22BrClN2O2S |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | tert-butyl 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C15H22BrClN2O2S/c1-15(2,3)21-14(20)19-6-4-10(5-7-19)18-9-11-8-12(16)13(17)22-11/h8,10,18H,4-7,9H2,1-3H3 |
| InChIKey | KCBPWBKQMCWRCM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |