C10H15BrClNO2S — CID 103527593
4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-1-methoxybutan-2-ol (PubChem CID 103527593) has the molecular formula C10H15BrClNO2S and a molecular weight of 328.66 g/mol. Its IUPAC name is 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-1-methoxybutan-2-ol.
| Compound Name | 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 103527593 |
| Molecular Formula | C10H15BrClNO2S |
| Molecular Weight | 328.66 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C10H15BrClNO2S/c1-15-6-7(14)2-3-13-5-8-4-9(11)10(12)16-8/h4,7,13-14H,2-3,5-6H2,1H3 |
| InChIKey | JMSVPCAHIGVNLC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|