C14H20BrNO4 — CID 103876219
4-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]-1-methoxybutan-2-ol (PubChem CID 103876219) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]-1-methoxybutan-2-ol.
| Compound Name | 4-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 103876219 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNCc1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C14H20BrNO4/c1-18-9-11(17)2-3-16-8-10-6-12(15)14-13(7-10)19-4-5-20-14/h6-7,11,16-17H,2-5,8-9H2,1H3 |
| InChIKey | UMEJWJRFHLBVTG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|