C16H25BrClNS — CID 102838187
N-[2-[1-[2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]ethyl]propan-2-amine (PubChem CID 102838187) has the molecular formula C16H25BrClNS and a molecular weight of 378.81 g/mol. Its IUPAC name is N-[2-[1-[2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]ethyl]propan-2-amine.
| Compound Name | N-[2-[1-[2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 102838187 |
| Molecular Formula | C16H25BrClNS |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-[2-[1-[2-(4-bromo-5-chlorothiophen-2-yl)ethyl]cyclopentyl]ethyl]propan-2-amine |
| SMILES | CC(C)NCCC1(CCc2cc(Br)c(Cl)s2)CCCC1 |
| InChI | InChI=1S/C16H25BrClNS/c1-12(2)19-10-9-16(6-3-4-7-16)8-5-13-11-14(17)15(18)20-13/h11-12,19H,3-10H2,1-2H3 |
| InChIKey | RNXNHMJOKUPJBU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |