C14H22ClNS — CID 102765261
2-[1-[2-(5-chloro-4-methylthiophen-2-yl)ethyl]cyclopentyl]ethanamine (PubChem CID 102765261) has the molecular formula C14H22ClNS and a molecular weight of 271.86 g/mol. Its IUPAC name is 2-[1-[2-(5-chloro-4-methylthiophen-2-yl)ethyl]cyclopentyl]ethanamine.
| Compound Name | 2-[1-[2-(5-chloro-4-methylthiophen-2-yl)ethyl]cyclopentyl]ethanamine |
|---|---|
| PubChem CID | 102765261 |
| Molecular Formula | C14H22ClNS |
| Molecular Weight | 271.86 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[1-[2-(5-chloro-4-methylthiophen-2-yl)ethyl]cyclopentyl]ethanamine |
| SMILES | Cc1cc(CCC2(CCN)CCCC2)sc1Cl |
| InChI | InChI=1S/C14H22ClNS/c1-11-10-12(17-13(11)15)4-7-14(8-9-16)5-2-3-6-14/h10H,2-9,16H2,1H3 |
| InChIKey | BBQWOVHEGCFJGY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |