About 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform
2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform (PubChem CID 175025312) has the molecular formula C11H23Cl3N2
and a molecular weight of 289.68 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform.
Molecular Properties
| Compound Name | 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform |
| PubChem CID | 175025312 |
| Molecular Formula | C11H23Cl3N2 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform |
| SMILES | ClC(Cl)Cl.NCCC1(CCN)CCCCC1 |
| InChI | InChI=1S/C10H22N2.CHCl3/c11-8-6-10(7-9-12)4-2-1-3-5-10;2-1(3)4/h1-9,11-12H2;1H |
| InChIKey | YZYKHVGSBIFPNV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform?
The IUPAC name of 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform (CID 175025312) is 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform.
What is the SMILES notation for 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform?
The canonical SMILES for 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform is ClC(Cl)Cl.NCCC1(CCN)CCCCC1.
What is the InChIKey of 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform?
The InChIKey is YZYKHVGSBIFPNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.CHCl3/c11-8-6-10(7-9-12)4-2-1-3-5-10;2-1(3)4/h1-9,11-12H2;1H.
What are the key properties of 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform?
2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform has a molecular weight of 289.68 g/mol, XLogP of 3.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-aminoethyl)cyclohexyl]ethanamine;chloroform is sourced from PubChem (CID 175025312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).