About [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride
[1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride (PubChem CID 10250859) has the molecular formula C8H18Cl2N2Pt
and a molecular weight of 408.23 g/mol. Its IUPAC name is [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride.
Molecular Properties
| Compound Name | [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride |
| PubChem CID | 10250859 |
| Molecular Formula | C8H18Cl2N2Pt |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride |
| SMILES | NCC1(CN)CCCCC1.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C8H18N2.2ClH.Pt/c9-6-8(7-10)4-2-1-3-5-8;;;/h1-7,9-10H2;2*1H;/q;;;+2/p-2 |
| InChIKey | UOYOUBSVFNVZKP-UHFFFAOYSA-L |
| XLogP | -5.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | -5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride?
The IUPAC name of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride (CID 10250859) is [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride.
What is the SMILES notation for [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride?
The canonical SMILES for [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride is NCC1(CN)CCCCC1.[Cl-].[Cl-].[Pt+2].
What is the InChIKey of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride?
The InChIKey is UOYOUBSVFNVZKP-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18N2.2ClH.Pt/c9-6-8(7-10)4-2-1-3-5-8;;;/h1-7,9-10H2;2*1H;/q;;;+2/p-2.
What are the key properties of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride?
[1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride has a molecular weight of 408.23 g/mol, XLogP of -5.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+);dichloride is sourced from PubChem (CID 10250859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).