C9H8Br2O4 — CID 142778160
(2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid (PubChem CID 142778160) has the molecular formula C9H8Br2O4 and a molecular weight of 339.97 g/mol. Its IUPAC name is (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 142778160 |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](O)Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C9H8Br2O4/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,12-13H,3H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | KXOPOMFBWDCGJG-ZETCQYMHSA-N |
| XLogP | 1.91 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |