About (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal
(2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal (PubChem CID 91554776) has the molecular formula C9H9Br2NO2
and a molecular weight of 322.98 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal.
Molecular Properties
| Compound Name | (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal |
| PubChem CID | 91554776 |
| Molecular Formula | C9H9Br2NO2 |
| Molecular Weight | 322.98 g/mol |
| Exact Mass | 320.90 |
| IUPAC Name | (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal |
| SMILES | N[C@@H](C=O)Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C9H9Br2NO2/c10-7-2-5(1-6(12)4-13)3-8(11)9(7)14/h2-4,6,14H,1,12H2/t6-/m1/s1 |
| InChIKey | HDTSWINHMHSCDM-ZCFIWIBFSA-N |
| XLogP | 1.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.98 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal?
The IUPAC name of (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal (CID 91554776) is (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal.
What is the SMILES notation for (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal?
The canonical SMILES for (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal is N[C@@H](C=O)Cc1cc(Br)c(O)c(Br)c1.
What is the InChIKey of (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal?
The InChIKey is HDTSWINHMHSCDM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H9Br2NO2/c10-7-2-5(1-6(12)4-13)3-8(11)9(7)14/h2-4,6,14H,1,12H2/t6-/m1/s1.
What are the key properties of (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal?
(2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal has a molecular weight of 322.98 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanal is sourced from PubChem (CID 91554776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).