C12H16Br2NO3+ — CID 23427668
[1-carboxy-2-(3,5-dibromo-4-hydroxyphenyl)ethyl]-trimethylazanium (PubChem CID 23427668) has the molecular formula C12H16Br2NO3+ and a molecular weight of 382.07 g/mol. Its IUPAC name is [1-carboxy-2-(3,5-dibromo-4-hydroxyphenyl)ethyl]-trimethylazanium.
| Compound Name | [1-carboxy-2-(3,5-dibromo-4-hydroxyphenyl)ethyl]-trimethylazanium |
|---|---|
| PubChem CID | 23427668 |
| Molecular Formula | C12H16Br2NO3+ |
| Molecular Weight | 382.07 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | [1-carboxy-2-(3,5-dibromo-4-hydroxyphenyl)ethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(Cc1cc(Br)c(O)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C12H15Br2NO3/c1-15(2,3)10(12(17)18)6-7-4-8(13)11(16)9(14)5-7/h4-5,10H,6H2,1-3H3,(H-,16,17,18)/p+1 |
| InChIKey | GLYRJOBFHAWKCJ-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|