C10H10O7 — CID 87115581
2-[(3,4,5-trihydroxyphenyl)methyl]propanedioic acid (PubChem CID 87115581) has the molecular formula C10H10O7 and a molecular weight of 242.18 g/mol. Its IUPAC name is 2-[(3,4,5-trihydroxyphenyl)methyl]propanedioic acid.
| Compound Name | 2-[(3,4,5-trihydroxyphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 87115581 |
| Molecular Formula | C10H10O7 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-[(3,4,5-trihydroxyphenyl)methyl]propanedioic acid |
| SMILES | O=C(O)C(Cc1cc(O)c(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H10O7/c11-6-2-4(3-7(12)8(6)13)1-5(9(14)15)10(16)17/h2-3,5,11-13H,1H2,(H,14,15)(H,16,17) |
| InChIKey | JLHSKTUQRBOJNU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|