C44H52O20 — CID 172870240
(2S,3S)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid;(2R,3R)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid (PubChem CID 172870240) has the molecular formula C44H52O20 and a molecular weight of 900.88 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid;(2R,3R)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid.
| Compound Name | (2S,3S)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid;(2R,3R)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 172870240 |
| Molecular Formula | C44H52O20 |
| Molecular Weight | 900.88 g/mol |
| Exact Mass | 900.31 |
| IUPAC Name | (2S,3S)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid;(2R,3R)-2,3-bis[(3,4-dihydroxy-5-methoxyphenyl)methyl]hexanedioic acid |
| SMILES | COc1cc(C[C@@H](CCC(=O)O)[C@@H](Cc2cc(O)c(O)c(OC)c2)C(=O)O)cc(O)c1O.COc1cc(C[C@H](CCC(=O)O)[C@H](Cc2cc(O)c(O)c(OC)c2)C(=O)O)cc(O)c1O |
| InChI | InChI=1S/2C22H26O10/c2*1-31-17-9-11(7-15(23)20(17)27)5-13(3-4-19(25)26)14(22(29)30)6-12-8-16(24)21(28)18(10-12)32-2/h2*7-10,13-14,23-24,27-28H,3-6H2,1-2H3,(H,25,26)(H,29,30)/t2*13-,14-/m10/s1 |
| InChIKey | LGDDRAAHUSWZJL-ATLWNKLRSA-N |
| XLogP | 4.99 |
| TPSA | 347.96 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.88 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|