3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid

C12H17NO5 — CID 45359257

IUPAC3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid
SMILESCNC(Cc1cc(OC)c(O)c(OC)c1)C(=O)O
InChIInChI=1S/C12H17NO5/c1-13-8(12(15)16)4-7-5-9(17-2)11(14)10(6-7)18-3/h5-6,8,13-14H,4H2,1-3H3,(H,15,16)
InChIKeyNJHRPZUBCWWEBC-UHFFFAOYSA-N
MW255.27 g/mol
LogP0.62
Rot. Bonds6

About 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid

3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid (PubChem CID 45359257) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid.

Molecular Properties

Compound Name3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid
PubChem CID45359257
Molecular FormulaC12H17NO5
Molecular Weight255.27 g/mol
Exact Mass255.11
IUPAC Name3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid
SMILESCNC(Cc1cc(OC)c(O)c(OC)c1)C(=O)O
InChIInChI=1S/C12H17NO5/c1-13-8(12(15)16)4-7-5-9(17-2)11(14)10(6-7)18-3/h5-6,8,13-14H,4H2,1-3H3,(H,15,16)
InChIKeyNJHRPZUBCWWEBC-UHFFFAOYSA-N
XLogP0.62
TPSA88.02 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 50.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid?
The IUPAC name of 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid (CID 45359257) is 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid.
What is the SMILES notation for 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid?
The canonical SMILES for 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid is CNC(Cc1cc(OC)c(O)c(OC)c1)C(=O)O.
What is the InChIKey of 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid?
The InChIKey is NJHRPZUBCWWEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5/c1-13-8(12(15)16)4-7-5-9(17-2)11(14)10(6-7)18-3/h5-6,8,13-14H,4H2,1-3H3,(H,15,16).
What are the key properties of 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid?
3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid has a molecular weight of 255.27 g/mol, XLogP of 0.62, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(methylamino)propanoic acid is sourced from PubChem (CID 45359257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).