C28H38O8 — CID 11851419
(2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioic acid (PubChem CID 11851419) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioic acid.
| Compound Name | (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 11851419 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioic acid |
| SMILES | COc1cc(C[C@@H](C(=O)O)[C@@H](Cc2cc(OC)c(O)c(C(C)(C)C)c2)C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H38O8/c1-27(2,3)19-11-15(13-21(35-7)23(19)29)9-17(25(31)32)18(26(33)34)10-16-12-20(28(4,5)6)24(30)22(14-16)36-8/h11-14,17-18,29-30H,9-10H2,1-8H3,(H,31,32)(H,33,34)/t17-,18-/m1/s1 |
| InChIKey | DZRIOJXVUGYWJA-QZTJIDSGSA-N |
| XLogP | 4.90 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |