C13H17F3O2 — CID 132552220
2-tert-butyl-6-methoxy-4-(2,2,2-trifluoroethyl)phenol (PubChem CID 132552220) has the molecular formula C13H17F3O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-tert-butyl-6-methoxy-4-(2,2,2-trifluoroethyl)phenol.
| Compound Name | 2-tert-butyl-6-methoxy-4-(2,2,2-trifluoroethyl)phenol |
|---|---|
| PubChem CID | 132552220 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-tert-butyl-6-methoxy-4-(2,2,2-trifluoroethyl)phenol |
| SMILES | COc1cc(CC(F)(F)F)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C13H17F3O2/c1-12(2,3)9-5-8(7-13(14,15)16)6-10(18-4)11(9)17/h5-6,17H,7H2,1-4H3 |
| InChIKey | NSJWKYAVYGPXMH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |