C12H17FO3 — CID 84691885
[3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]methanol (PubChem CID 84691885) has the molecular formula C12H17FO3 and a molecular weight of 228.26 g/mol. Its IUPAC name is [3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]methanol.
| Compound Name | [3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 84691885 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(C(C)(C)F)c1OC |
| InChI | InChI=1S/C12H17FO3/c1-12(2,13)9-5-8(7-14)6-10(15-3)11(9)16-4/h5-6,14H,7H2,1-4H3 |
| InChIKey | XQYOYPHGBXQFOY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |