C13H17FO3 — CID 117353223
1-[3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]ethanone (PubChem CID 117353223) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-[3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]ethanone.
| Compound Name | 1-[3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 117353223 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-[3-(2-fluoropropan-2-yl)-4,5-dimethoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)cc(C(C)(C)F)c1OC |
| InChI | InChI=1S/C13H17FO3/c1-8(15)9-6-10(13(2,3)14)12(17-5)11(7-9)16-4/h6-7H,1-5H3 |
| InChIKey | DUAMEQXBBVJSGA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |