C22H27NO9 — CID 172943589
(2E)-2-hydroxyimino-1-(3,4,5-trimethoxyphenyl)ethanone;1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 172943589) has the molecular formula C22H27NO9 and a molecular weight of 449.46 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-1-(3,4,5-trimethoxyphenyl)ethanone;1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | (2E)-2-hydroxyimino-1-(3,4,5-trimethoxyphenyl)ethanone;1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 172943589 |
| Molecular Formula | C22H27NO9 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (2E)-2-hydroxyimino-1-(3,4,5-trimethoxyphenyl)ethanone;1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)/C=N/O)cc(OC)c1OC.COc1cc(C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C11H13NO5.C11H14O4/c1-15-9-4-7(8(13)6-12-14)5-10(16-2)11(9)17-3;1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h4-6,14H,1-3H3;5-6H,1-4H3/b12-6+; |
| InChIKey | AKWGYFQVAAUOTH-WXIWBVQFSA-N |
| XLogP | 3.27 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|