C20H22O10S — CID 88824717
(3,4,5-trimethoxybenzoyl)sulfonyl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 88824717) has the molecular formula C20H22O10S and a molecular weight of 454.45 g/mol. Its IUPAC name is (3,4,5-trimethoxybenzoyl)sulfonyl-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (3,4,5-trimethoxybenzoyl)sulfonyl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 88824717 |
| Molecular Formula | C20H22O10S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (3,4,5-trimethoxybenzoyl)sulfonyl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)S(=O)(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22O10S/c1-25-13-7-11(8-14(26-2)17(13)29-5)19(21)31(23,24)20(22)12-9-15(27-3)18(30-6)16(10-12)28-4/h7-10H,1-6H3 |
| InChIKey | DFJQSBATTXCBPT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|