C12H13ClO4 — CID 175261663
2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride (PubChem CID 175261663) has the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride |
|---|---|
| PubChem CID | 175261663 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride |
| SMILES | C=C(C(=O)Cl)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H13ClO4/c1-7(12(13)14)8-5-9(15-2)11(17-4)10(6-8)16-3/h5-6H,1H2,2-4H3 |
| InChIKey | LMAYDGUQIWYAKP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|