2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride

C12H13ClO4 — CID 175261663

IUPAC2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride
SMILESC=C(C(=O)Cl)c1cc(OC)c(OC)c(OC)c1
InChIInChI=1S/C12H13ClO4/c1-7(12(13)14)8-5-9(15-2)11(17-4)10(6-8)16-3/h5-6H,1H2,2-4H3
InChIKeyLMAYDGUQIWYAKP-UHFFFAOYSA-N
MW256.68 g/mol
LogP2.49
Rot. Bonds5

About 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride

2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride (PubChem CID 175261663) has the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride.

Molecular Properties

Compound Name2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride
PubChem CID175261663
Molecular FormulaC12H13ClO4
Molecular Weight256.68 g/mol
Exact Mass256.05
IUPAC Name2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride
SMILESC=C(C(=O)Cl)c1cc(OC)c(OC)c(OC)c1
InChIInChI=1S/C12H13ClO4/c1-7(12(13)14)8-5-9(15-2)11(17-4)10(6-8)16-3/h5-6H,1H2,2-4H3
InChIKeyLMAYDGUQIWYAKP-UHFFFAOYSA-N
XLogP2.49
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.68
LogP ≤ 52.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride?
The IUPAC name of 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride (CID 175261663) is 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride.
What is the SMILES notation for 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride?
The canonical SMILES for 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride is C=C(C(=O)Cl)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride?
The InChIKey is LMAYDGUQIWYAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO4/c1-7(12(13)14)8-5-9(15-2)11(17-4)10(6-8)16-3/h5-6H,1H2,2-4H3.
What are the key properties of 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride?
2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride has a molecular weight of 256.68 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride is sourced from PubChem (CID 175261663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).