C10H13NaO5 — CID 145079800
sodium;molecular hydrogen;3,4,5-trimethoxybenzoate (PubChem CID 145079800) has the molecular formula C10H13NaO5 and a molecular weight of 236.20 g/mol. Its IUPAC name is sodium;molecular hydrogen;3,4,5-trimethoxybenzoate.
| Compound Name | sodium;molecular hydrogen;3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 145079800 |
| Molecular Formula | C10H13NaO5 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | sodium;molecular hydrogen;3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)[O-])cc(OC)c1OC.[H][H].[Na+] |
| InChI | InChI=1S/C10H12O5.Na.H2/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3;;/h4-5H,1-3H3,(H,11,12);;1H/q;+1;/p-1 |
| InChIKey | POPKCAHUWMFWOV-UHFFFAOYSA-M |
| XLogP | -2.67 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |