C15H14NO5- — CID 22938063
2-(3,4,5-trimethoxyphenyl)pyridine-4-carboxylate (PubChem CID 22938063) has the molecular formula C15H14NO5- and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)pyridine-4-carboxylate.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 22938063 |
| Molecular Formula | C15H14NO5- |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)pyridine-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)[O-])ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15NO5/c1-19-12-7-10(8-13(20-2)14(12)21-3)11-6-9(15(17)18)4-5-16-11/h4-8H,1-3H3,(H,17,18)/p-1 |
| InChIKey | ZLOPNYLSAXNARA-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 80.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |